C10H17ClN2O2S2 — CID 116816033
4-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)butane-1-sulfonamide (PubChem CID 116816033) has the molecular formula C10H17ClN2O2S2 and a molecular weight of 296.85 g/mol. Its IUPAC name is 4-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116816033 |
| Molecular Formula | C10H17ClN2O2S2 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)butane-1-sulfonamide |
| SMILES | CCc1nc(NS(=O)(=O)CCCCCl)sc1C |
| InChI | InChI=1S/C10H17ClN2O2S2/c1-3-9-8(2)16-10(12-9)13-17(14,15)7-5-4-6-11/h3-7H2,1-2H3,(H,12,13) |
| InChIKey | FNWZDRIFWNZJKZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|