C11H15ClN2O2S2 — CID 116814947
4-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)butane-1-sulfonamide (PubChem CID 116814947) has the molecular formula C11H15ClN2O2S2 and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116814947 |
| Molecular Formula | C11H15ClN2O2S2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)butane-1-sulfonamide |
| SMILES | Cc1sc(NS(=O)(=O)CCCCCl)c(C#N)c1C |
| InChI | InChI=1S/C11H15ClN2O2S2/c1-8-9(2)17-11(10(8)7-13)14-18(15,16)6-4-3-5-12/h14H,3-6H2,1-2H3 |
| InChIKey | ASWKLOZLCUVFJZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|