C14H15N3O2S2 — CID 61109836
3-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methylbenzenesulfonamide (PubChem CID 61109836) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 3-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | 3-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61109836 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2sc(C)c(C)c2C#N)cc1N |
| InChI | InChI=1S/C14H15N3O2S2/c1-8-4-5-11(6-13(8)16)21(18,19)17-14-12(7-15)9(2)10(3)20-14/h4-6,17H,16H2,1-3H3 |
| InChIKey | PMPAHYYFCBHUMX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|