C13H12FN3O2S2 — CID 82845468
4-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-fluorobenzenesulfonamide (PubChem CID 82845468) has the molecular formula C13H12FN3O2S2 and a molecular weight of 325.39 g/mol. Its IUPAC name is 4-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 82845468 |
| Molecular Formula | C13H12FN3O2S2 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 4-amino-N-(3-cyano-4,5-dimethylthiophen-2-yl)-3-fluorobenzenesulfonamide |
| SMILES | Cc1sc(NS(=O)(=O)c2ccc(N)c(F)c2)c(C#N)c1C |
| InChI | InChI=1S/C13H12FN3O2S2/c1-7-8(2)20-13(10(7)6-15)17-21(18,19)9-3-4-12(16)11(14)5-9/h3-5,17H,16H2,1-2H3 |
| InChIKey | PLAQKQXTMGCULC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|