C12H10ClN3O2S2 — CID 61052071
2-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)pyridine-3-sulfonamide (PubChem CID 61052071) has the molecular formula C12H10ClN3O2S2 and a molecular weight of 327.82 g/mol. Its IUPAC name is 2-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61052071 |
| Molecular Formula | C12H10ClN3O2S2 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 2-chloro-N-(3-cyano-4,5-dimethylthiophen-2-yl)pyridine-3-sulfonamide |
| SMILES | Cc1sc(NS(=O)(=O)c2cccnc2Cl)c(C#N)c1C |
| InChI | InChI=1S/C12H10ClN3O2S2/c1-7-8(2)19-12(9(7)6-14)16-20(17,18)10-4-3-5-15-11(10)13/h3-5,16H,1-2H3 |
| InChIKey | PRDOLQZOZQRZRZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|