C8H11N5O2 — CID 114387755
3-amino-N-(1,2,4-triazin-3-yl)oxolane-3-carboxamide (PubChem CID 114387755) has the molecular formula C8H11N5O2 and a molecular weight of 209.21 g/mol. Its IUPAC name is 3-amino-N-(1,2,4-triazin-3-yl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(1,2,4-triazin-3-yl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 114387755 |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 3-amino-N-(1,2,4-triazin-3-yl)oxolane-3-carboxamide |
| SMILES | NC1(C(=O)Nc2nccnn2)CCOC1 |
| InChI | InChI=1S/C8H11N5O2/c9-8(1-4-15-5-8)6(14)12-7-10-2-3-11-13-7/h2-3H,1,4-5,9H2,(H,10,12,13,14) |
| InChIKey | MFXJODPUWRCITI-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |