C10H14N4O2 — CID 115293590
4-amino-N-pyrimidin-2-yloxane-4-carboxamide (PubChem CID 115293590) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 4-amino-N-pyrimidin-2-yloxane-4-carboxamide.
| Compound Name | 4-amino-N-pyrimidin-2-yloxane-4-carboxamide |
|---|---|
| PubChem CID | 115293590 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 4-amino-N-pyrimidin-2-yloxane-4-carboxamide |
| SMILES | NC1(C(=O)Nc2ncccn2)CCOCC1 |
| InChI | InChI=1S/C10H14N4O2/c11-10(2-6-16-7-3-10)8(15)14-9-12-4-1-5-13-9/h1,4-5H,2-3,6-7,11H2,(H,12,13,14,15) |
| InChIKey | SCLGBJLNFNLBQR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |