C13H11N5O3 — CID 114388755
1-(1,2,4-triazin-3-ylcarbamoyl)-2,3-dihydroindole-3-carboxylic acid (PubChem CID 114388755) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1-(1,2,4-triazin-3-ylcarbamoyl)-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-(1,2,4-triazin-3-ylcarbamoyl)-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 114388755 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 1-(1,2,4-triazin-3-ylcarbamoyl)-2,3-dihydroindole-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)Nc2nccnn2)c2ccccc21 |
| InChI | InChI=1S/C13H11N5O3/c19-11(20)9-7-18(10-4-2-1-3-8(9)10)13(21)16-12-14-5-6-15-17-12/h1-6,9H,7H2,(H,19,20)(H,14,16,17,21) |
| InChIKey | FRYYIJAMHZGUIF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |