C15H15N5O — CID 114388989
4-(1H-indol-3-yl)-N-(1,2,4-triazin-3-yl)butanamide (PubChem CID 114388989) has the molecular formula C15H15N5O and a molecular weight of 281.32 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-(1,2,4-triazin-3-yl)butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-(1,2,4-triazin-3-yl)butanamide |
|---|---|
| PubChem CID | 114388989 |
| Molecular Formula | C15H15N5O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-(1,2,4-triazin-3-yl)butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)Nc1nccnn1 |
| InChI | InChI=1S/C15H15N5O/c21-14(19-15-16-8-9-18-20-15)7-3-4-11-10-17-13-6-2-1-5-12(11)13/h1-2,5-6,8-10,17H,3-4,7H2,(H,16,19,20,21) |
| InChIKey | ZPLUPQOXHCTLFM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |