C15H14N4O2 — CID 114389062
3-(4-hydroxybut-1-ynyl)-4-methyl-N-(1,2,4-triazin-3-yl)benzamide (PubChem CID 114389062) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynyl)-4-methyl-N-(1,2,4-triazin-3-yl)benzamide.
| Compound Name | 3-(4-hydroxybut-1-ynyl)-4-methyl-N-(1,2,4-triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 114389062 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-(4-hydroxybut-1-ynyl)-4-methyl-N-(1,2,4-triazin-3-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2nccnn2)cc1C#CCCO |
| InChI | InChI=1S/C15H14N4O2/c1-11-5-6-13(10-12(11)4-2-3-9-20)14(21)18-15-16-7-8-17-19-15/h5-8,10,20H,3,9H2,1H3,(H,16,18,19,21) |
| InChIKey | PBRJOQPRRMEWKV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|