C21H30O3 — CID 11438929
(1S,5S,6R,11S)-11,15,18,18-tetramethyl-7-methylidene-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-one (PubChem CID 11438929) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (1S,5S,6R,11S)-11,15,18,18-tetramethyl-7-methylidene-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-one.
| Compound Name | (1S,5S,6R,11S)-11,15,18,18-tetramethyl-7-methylidene-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-one |
|---|---|
| PubChem CID | 11438929 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (1S,5S,6R,11S)-11,15,18,18-tetramethyl-7-methylidene-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-13-one |
| SMILES | C=C1CCC[C@@]2(C)CC(=O)C3=C(C)CC[C@]4(OCO[C@H]4[C@H]12)C3(C)C |
| InChI | InChI=1S/C21H30O3/c1-13-7-6-9-20(5)11-15(22)16-14(2)8-10-21(19(16,3)4)18(17(13)20)23-12-24-21/h17-18H,1,6-12H2,2-5H3/t17-,18-,20-,21+/m0/s1 |
| InChIKey | NCBXKDQDXIXYPO-JYAXBFRTSA-N |
| XLogP | 4.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|