C19H25NO4 — CID 11438952
(4R,5S)-3-[(2R,3S,4S)-3-hydroxy-2,4-dimethylhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 11438952) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (4R,5S)-3-[(2R,3S,4S)-3-hydroxy-2,4-dimethylhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R,3S,4S)-3-hydroxy-2,4-dimethylhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11438952 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (4R,5S)-3-[(2R,3S,4S)-3-hydroxy-2,4-dimethylhept-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](C)[C@H](O)[C@@H](C)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H25NO4/c1-5-9-12(2)16(21)13(3)18(22)20-14(4)17(24-19(20)23)15-10-7-6-8-11-15/h5-8,10-14,16-17,21H,1,9H2,2-4H3/t12-,13+,14+,16-,17+/m0/s1 |
| InChIKey | DWZFGGDGFKCQFA-BBOXDSQKSA-N |
| XLogP | 3.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|