C14H19N3O4 — CID 114394128
(E)-4-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]but-2-enoic acid (PubChem CID 114394128) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (E)-4-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]but-2-enoic acid.
| Compound Name | (E)-4-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 114394128 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (E)-4-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]but-2-enoic acid |
| SMILES | CC1(C)CN(c2cnn(C/C=C/C(=O)O)c(=O)c2)CCO1 |
| InChI | InChI=1S/C14H19N3O4/c1-14(2)10-16(6-7-21-14)11-8-12(18)17(15-9-11)5-3-4-13(19)20/h3-4,8-9H,5-7,10H2,1-2H3,(H,19,20)/b4-3+ |
| InChIKey | NVLIUOFZEVMAAH-ONEGZZNKSA-N |
| XLogP | 0.50 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|