C14H22N4O2S — CID 114395846
3-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]-2-methylpropanethioamide (PubChem CID 114395846) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]-2-methylpropanethioamide.
| Compound Name | 3-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 114395846 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-[4-(2,2-dimethylmorpholin-4-yl)-6-oxopyridazin-1-yl]-2-methylpropanethioamide |
| SMILES | CC(Cn1ncc(N2CCOC(C)(C)C2)cc1=O)C(N)=S |
| InChI | InChI=1S/C14H22N4O2S/c1-10(13(15)21)8-18-12(19)6-11(7-16-18)17-4-5-20-14(2,3)9-17/h6-7,10H,4-5,8-9H2,1-3H3,(H2,15,21) |
| InChIKey | QNQBESZPSIKXGF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|