C15H23N3O2S — CID 114399199
5-(2,2-dimethylmorpholin-4-yl)-2-[[1-(sulfanylmethyl)cyclopropyl]methyl]pyridazin-3-one (PubChem CID 114399199) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 5-(2,2-dimethylmorpholin-4-yl)-2-[[1-(sulfanylmethyl)cyclopropyl]methyl]pyridazin-3-one.
| Compound Name | 5-(2,2-dimethylmorpholin-4-yl)-2-[[1-(sulfanylmethyl)cyclopropyl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114399199 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 5-(2,2-dimethylmorpholin-4-yl)-2-[[1-(sulfanylmethyl)cyclopropyl]methyl]pyridazin-3-one |
| SMILES | CC1(C)CN(c2cnn(CC3(CS)CC3)c(=O)c2)CCO1 |
| InChI | InChI=1S/C15H23N3O2S/c1-14(2)9-17(5-6-20-14)12-7-13(19)18(16-8-12)10-15(11-21)3-4-15/h7-8,21H,3-6,9-11H2,1-2H3 |
| InChIKey | RMSATJJEQMTUIP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|