C12H19N5O3 — CID 114394188
2-amino-3-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]propanamide (PubChem CID 114394188) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-amino-3-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]propanamide.
| Compound Name | 2-amino-3-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]propanamide |
|---|---|
| PubChem CID | 114394188 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-amino-3-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]propanamide |
| SMILES | COC1CCN(c2cnn(CC(N)C(N)=O)c(=O)c2)C1 |
| InChI | InChI=1S/C12H19N5O3/c1-20-9-2-3-16(6-9)8-4-11(18)17(15-5-8)7-10(13)12(14)19/h4-5,9-10H,2-3,6-7,13H2,1H3,(H2,14,19) |
| InChIKey | PKUOETYGHQBCCU-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |