C14H21N3O4 — CID 114394176
propan-2-yl 2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate (PubChem CID 114394176) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is propan-2-yl 2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate.
| Compound Name | propan-2-yl 2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate |
|---|---|
| PubChem CID | 114394176 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | propan-2-yl 2-[4-(3-methoxypyrrolidin-1-yl)-6-oxopyridazin-1-yl]acetate |
| SMILES | COC1CCN(c2cnn(CC(=O)OC(C)C)c(=O)c2)C1 |
| InChI | InChI=1S/C14H21N3O4/c1-10(2)21-14(19)9-17-13(18)6-11(7-15-17)16-5-4-12(8-16)20-3/h6-7,10,12H,4-5,8-9H2,1-3H3 |
| InChIKey | ZVQCHNBHSREGAM-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |