C11H16BF3KN3O2 — CID 114398775
potassium trifluoro-[[4-(4-methoxypiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide (PubChem CID 114398775) has the molecular formula C11H16BF3KN3O2 and a molecular weight of 329.17 g/mol. Its IUPAC name is potassium trifluoro-[[4-(4-methoxypiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide.
| Compound Name | potassium trifluoro-[[4-(4-methoxypiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide |
|---|---|
| PubChem CID | 114398775 |
| Molecular Formula | C11H16BF3KN3O2 |
| Molecular Weight | 329.17 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | potassium trifluoro-[[4-(4-methoxypiperidin-1-yl)-6-oxopyridazin-1-yl]methyl]boranuide |
| SMILES | COC1CCN(c2cnn(C[B-](F)(F)F)c(=O)c2)CC1.[K+] |
| InChI | InChI=1S/C11H16BF3N3O2.K/c1-20-10-2-4-17(5-3-10)9-6-11(19)18(16-7-9)8-12(13,14)15;/h6-7,10H,2-5,8H2,1H3;/q-1;+1 |
| InChIKey | YWMLFJDXXXUDMW-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.17 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|