C13H21N3O3 — CID 114396739
2-(3-hydroxybutyl)-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one (PubChem CID 114396739) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(3-hydroxybutyl)-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one.
| Compound Name | 2-(3-hydroxybutyl)-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 114396739 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-(3-hydroxybutyl)-5-(3-methoxypyrrolidin-1-yl)pyridazin-3-one |
| SMILES | COC1CCN(c2cnn(CCC(C)O)c(=O)c2)C1 |
| InChI | InChI=1S/C13H21N3O3/c1-10(17)3-6-16-13(18)7-11(8-14-16)15-5-4-12(9-15)19-2/h7-8,10,12,17H,3-6,9H2,1-2H3 |
| InChIKey | JEFMZMGZXGGALN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |