C6H16N2O — CID 114396633
1-N-methoxy-1-N,2-N-dimethylpropane-1,2-diamine (PubChem CID 114396633) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is 1-N-methoxy-1-N,2-N-dimethylpropane-1,2-diamine.
| Compound Name | 1-N-methoxy-1-N,2-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 114396633 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 1-N-methoxy-1-N,2-N-dimethylpropane-1,2-diamine |
| SMILES | CNC(C)CN(C)OC |
| InChI | InChI=1S/C6H16N2O/c1-6(7-2)5-8(3)9-4/h6-7H,5H2,1-4H3 |
| InChIKey | JCRNFLSNBWTNDN-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|