C6H17N3 — CID 123856605
1-(2,2-dimethylhydrazinyl)-N-methylpropan-2-amine (PubChem CID 123856605) has the molecular formula C6H17N3 and a molecular weight of 131.22 g/mol. Its IUPAC name is 1-(2,2-dimethylhydrazinyl)-N-methylpropan-2-amine.
| Compound Name | 1-(2,2-dimethylhydrazinyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 123856605 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | 1-(2,2-dimethylhydrazinyl)-N-methylpropan-2-amine |
| SMILES | CNC(C)CNN(C)C |
| InChI | InChI=1S/C6H17N3/c1-6(7-2)5-8-9(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | YWCOKVWZZIFUIU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|