C6H15FN2 — CID 130504617
1-N-(2-fluoroethyl)-2-N-methylpropane-1,2-diamine (PubChem CID 130504617) has the molecular formula C6H15FN2 and a molecular weight of 134.20 g/mol. Its IUPAC name is 1-N-(2-fluoroethyl)-2-N-methylpropane-1,2-diamine.
| Compound Name | 1-N-(2-fluoroethyl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 130504617 |
| Molecular Formula | C6H15FN2 |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.12 |
| IUPAC Name | 1-N-(2-fluoroethyl)-2-N-methylpropane-1,2-diamine |
| SMILES | CNC(C)CNCCF |
| InChI | InChI=1S/C6H15FN2/c1-6(8-2)5-9-4-3-7/h6,8-9H,3-5H2,1-2H3 |
| InChIKey | DNCLCAVNOGXCKC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|