C6H12F3N — CID 130643475
4,4-difluoro-N-(2-fluoroethyl)butan-2-amine (PubChem CID 130643475) has the molecular formula C6H12F3N and a molecular weight of 155.16 g/mol. Its IUPAC name is 4,4-difluoro-N-(2-fluoroethyl)butan-2-amine.
| Compound Name | 4,4-difluoro-N-(2-fluoroethyl)butan-2-amine |
|---|---|
| PubChem CID | 130643475 |
| Molecular Formula | C6H12F3N |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4,4-difluoro-N-(2-fluoroethyl)butan-2-amine |
| SMILES | CC(CC(F)F)NCCF |
| InChI | InChI=1S/C6H12F3N/c1-5(4-6(8)9)10-3-2-7/h5-6,10H,2-4H2,1H3 |
| InChIKey | CBZFFJKGBMFFHC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |