C8H18N2O3 — CID 82722296
2-(2-methoxyethoxyamino)-N,N-dimethylpropanamide (PubChem CID 82722296) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-(2-methoxyethoxyamino)-N,N-dimethylpropanamide.
| Compound Name | 2-(2-methoxyethoxyamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 82722296 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 2-(2-methoxyethoxyamino)-N,N-dimethylpropanamide |
| SMILES | COCCONC(C)C(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O3/c1-7(8(11)10(2)3)9-13-6-5-12-4/h7,9H,5-6H2,1-4H3 |
| InChIKey | CKCOPQACFGBZPG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|