C7H15N3O4 — CID 79676152
2-(carbamoylamino)-N-(2-methoxyethoxy)propanamide (PubChem CID 79676152) has the molecular formula C7H15N3O4 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(2-methoxyethoxy)propanamide.
| Compound Name | 2-(carbamoylamino)-N-(2-methoxyethoxy)propanamide |
|---|---|
| PubChem CID | 79676152 |
| Molecular Formula | C7H15N3O4 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-(carbamoylamino)-N-(2-methoxyethoxy)propanamide |
| SMILES | COCCONC(=O)C(C)NC(N)=O |
| InChI | InChI=1S/C7H15N3O4/c1-5(9-7(8)12)6(11)10-14-4-3-13-2/h5H,3-4H2,1-2H3,(H,10,11)(H3,8,9,12) |
| InChIKey | MXGLPTJZAIHJAL-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|