C9H20N2O5S — CID 79675663
N-(2-methoxyethoxy)-2-(propylsulfonylamino)propanamide (PubChem CID 79675663) has the molecular formula C9H20N2O5S and a molecular weight of 268.33 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-2-(propylsulfonylamino)propanamide.
| Compound Name | N-(2-methoxyethoxy)-2-(propylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 79675663 |
| Molecular Formula | C9H20N2O5S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-(2-methoxyethoxy)-2-(propylsulfonylamino)propanamide |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)NOCCOC |
| InChI | InChI=1S/C9H20N2O5S/c1-4-7-17(13,14)11-8(2)9(12)10-16-6-5-15-3/h8,11H,4-7H2,1-3H3,(H,10,12) |
| InChIKey | WROAJEFCHQNWMS-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|