C12H26N2O4S — CID 55082542
N-[3-(hydroxymethyl)pentan-3-yl]-2-(propylsulfonylamino)propanamide (PubChem CID 55082542) has the molecular formula C12H26N2O4S and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[3-(hydroxymethyl)pentan-3-yl]-2-(propylsulfonylamino)propanamide.
| Compound Name | N-[3-(hydroxymethyl)pentan-3-yl]-2-(propylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55082542 |
| Molecular Formula | C12H26N2O4S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[3-(hydroxymethyl)pentan-3-yl]-2-(propylsulfonylamino)propanamide |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)NC(CC)(CC)CO |
| InChI | InChI=1S/C12H26N2O4S/c1-5-8-19(17,18)14-10(4)11(16)13-12(6-2,7-3)9-15/h10,14-15H,5-9H2,1-4H3,(H,13,16) |
| InChIKey | TXVJGINIHFTASW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |