C9H20N2O4S — CID 83032343
N-[(2R)-2-hydroxypropyl]-2-(propylsulfonylamino)propanamide (PubChem CID 83032343) has the molecular formula C9H20N2O4S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-2-(propylsulfonylamino)propanamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-2-(propylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 83032343 |
| Molecular Formula | C9H20N2O4S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-2-(propylsulfonylamino)propanamide |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)NC[C@@H](C)O |
| InChI | InChI=1S/C9H20N2O4S/c1-4-5-16(14,15)11-8(3)9(13)10-6-7(2)12/h7-8,11-12H,4-6H2,1-3H3,(H,10,13)/t7-,8?/m1/s1 |
| InChIKey | LSRPEXKGVNGUKP-GVHYBUMESA-N |
| XLogP | -0.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |