C11H24N2O5S — CID 103877484
N-(3-hydroxy-4-methoxybutyl)-2-(propylsulfonylamino)propanamide (PubChem CID 103877484) has the molecular formula C11H24N2O5S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(3-hydroxy-4-methoxybutyl)-2-(propylsulfonylamino)propanamide.
| Compound Name | N-(3-hydroxy-4-methoxybutyl)-2-(propylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 103877484 |
| Molecular Formula | C11H24N2O5S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(3-hydroxy-4-methoxybutyl)-2-(propylsulfonylamino)propanamide |
| SMILES | CCCS(=O)(=O)NC(C)C(=O)NCCC(O)COC |
| InChI | InChI=1S/C11H24N2O5S/c1-4-7-19(16,17)13-9(2)11(15)12-6-5-10(14)8-18-3/h9-10,13-14H,4-8H2,1-3H3,(H,12,15) |
| InChIKey | BMTWEWCZDWNJMB-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |