C8H17ClN2O3S — CID 107651325
2-(2-chloroethylsulfonylamino)-N-propylpropanamide (PubChem CID 107651325) has the molecular formula C8H17ClN2O3S and a molecular weight of 256.75 g/mol. Its IUPAC name is 2-(2-chloroethylsulfonylamino)-N-propylpropanamide.
| Compound Name | 2-(2-chloroethylsulfonylamino)-N-propylpropanamide |
|---|---|
| PubChem CID | 107651325 |
| Molecular Formula | C8H17ClN2O3S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-(2-chloroethylsulfonylamino)-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NS(=O)(=O)CCCl |
| InChI | InChI=1S/C8H17ClN2O3S/c1-3-5-10-8(12)7(2)11-15(13,14)6-4-9/h7,11H,3-6H2,1-2H3,(H,10,12) |
| InChIKey | XHVQBYPEUZSQBI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|