C14H18F2N4O — CID 114400774
1-[(4-ethylmorpholin-2-yl)methyl]-6,7-difluorobenzimidazol-2-amine (PubChem CID 114400774) has the molecular formula C14H18F2N4O and a molecular weight of 296.32 g/mol. Its IUPAC name is 1-[(4-ethylmorpholin-2-yl)methyl]-6,7-difluorobenzimidazol-2-amine.
| Compound Name | 1-[(4-ethylmorpholin-2-yl)methyl]-6,7-difluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 114400774 |
| Molecular Formula | C14H18F2N4O |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[(4-ethylmorpholin-2-yl)methyl]-6,7-difluorobenzimidazol-2-amine |
| SMILES | CCN1CCOC(Cn2c(N)nc3ccc(F)c(F)c32)C1 |
| InChI | InChI=1S/C14H18F2N4O/c1-2-19-5-6-21-9(7-19)8-20-13-11(18-14(20)17)4-3-10(15)12(13)16/h3-4,9H,2,5-8H2,1H3,(H2,17,18) |
| InChIKey | LUBWTXCCUXNTPH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |