C15H27NO — CID 114404529
4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine (PubChem CID 114404529) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 114404529 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 4-[(3,3,5-trimethylcyclohexyl)oxymethyl]-1,2,3,6-tetrahydropyridine |
| SMILES | CC1CC(OCC2=CCNCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H27NO/c1-12-8-14(10-15(2,3)9-12)17-11-13-4-6-16-7-5-13/h4,12,14,16H,5-11H2,1-3H3 |
| InChIKey | BTEPQPQVOXGGTE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|