C12H20N2O2 — CID 114409690
2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pent-4-en-1-one (PubChem CID 114409690) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pent-4-en-1-one.
| Compound Name | 2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 114409690 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-amino-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]pent-4-en-1-one |
| SMILES | C=CCC(N)C(=O)N1CC=C(COC)CC1 |
| InChI | InChI=1S/C12H20N2O2/c1-3-4-11(13)12(15)14-7-5-10(6-8-14)9-16-2/h3,5,11H,1,4,6-9,13H2,2H3 |
| InChIKey | YBGYHMIQUZUAKS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|