C13H14BrNO — CID 114410216
1-[4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanone (PubChem CID 114410216) has the molecular formula C13H14BrNO and a molecular weight of 280.17 g/mol. Its IUPAC name is 1-[4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanone.
| Compound Name | 1-[4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 114410216 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 1-[4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Br)cc1N1CC=CCC1 |
| InChI | InChI=1S/C13H14BrNO/c1-10(16)12-6-5-11(14)9-13(12)15-7-3-2-4-8-15/h2-3,5-6,9H,4,7-8H2,1H3 |
| InChIKey | XELROZXCESRUJZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|