C12H12BrNO2 — CID 114411186
4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid (PubChem CID 114411186) has the molecular formula C12H12BrNO2 and a molecular weight of 282.14 g/mol. Its IUPAC name is 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid.
| Compound Name | 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 114411186 |
| Molecular Formula | C12H12BrNO2 |
| Molecular Weight | 282.14 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(Br)cc1N1CC=CCC1 |
| InChI | InChI=1S/C12H12BrNO2/c13-9-4-5-10(12(15)16)11(8-9)14-6-2-1-3-7-14/h1-2,4-5,8H,3,6-7H2,(H,15,16) |
| InChIKey | WTFLILZKEBAJCV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.14 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|