4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid

C12H12BrNO2 — CID 114411186

IUPAC4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid
SMILESO=C(O)c1ccc(Br)cc1N1CC=CCC1
InChIInChI=1S/C12H12BrNO2/c13-9-4-5-10(12(15)16)11(8-9)14-6-2-1-3-7-14/h1-2,4-5,8H,3,6-7H2,(H,15,16)
InChIKeyWTFLILZKEBAJCV-UHFFFAOYSA-N
MW282.14 g/mol
LogP2.91
Rot. Bonds2

About 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid

4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid (PubChem CID 114411186) has the molecular formula C12H12BrNO2 and a molecular weight of 282.14 g/mol. Its IUPAC name is 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid.

Molecular Properties

Compound Name4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid
PubChem CID114411186
Molecular FormulaC12H12BrNO2
Molecular Weight282.14 g/mol
Exact Mass281.01
IUPAC Name4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid
SMILESO=C(O)c1ccc(Br)cc1N1CC=CCC1
InChIInChI=1S/C12H12BrNO2/c13-9-4-5-10(12(15)16)11(8-9)14-6-2-1-3-7-14/h1-2,4-5,8H,3,6-7H2,(H,15,16)
InChIKeyWTFLILZKEBAJCV-UHFFFAOYSA-N
XLogP2.91
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.14
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
The IUPAC name of 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid (CID 114411186) is 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid.
What is the SMILES notation for 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
The canonical SMILES for 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid is O=C(O)c1ccc(Br)cc1N1CC=CCC1.
What is the InChIKey of 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
The InChIKey is WTFLILZKEBAJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO2/c13-9-4-5-10(12(15)16)11(8-9)14-6-2-1-3-7-14/h1-2,4-5,8H,3,6-7H2,(H,15,16).
What are the key properties of 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid?
4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid has a molecular weight of 282.14 g/mol, XLogP of 2.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(3,6-dihydro-2H-pyridin-1-yl)benzoic acid is sourced from PubChem (CID 114411186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).