C15H16BrN3OS — CID 82956334
1-[4-bromo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanone (PubChem CID 82956334) has the molecular formula C15H16BrN3OS and a molecular weight of 366.28 g/mol. Its IUPAC name is 1-[4-bromo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-bromo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 82956334 |
| Molecular Formula | C15H16BrN3OS |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 1-[4-bromo-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Br)cc1N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H16BrN3OS/c1-11(20)13-3-2-12(16)10-14(13)18-5-7-19(8-6-18)15-17-4-9-21-15/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | QMRZUTUELUPQSG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |