C13H25N3 — CID 114410727
1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1,4-diazepane (PubChem CID 114410727) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1,4-diazepane.
| Compound Name | 1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1,4-diazepane |
|---|---|
| PubChem CID | 114410727 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethyl]-1,4-diazepane |
| SMILES | CC1=CCN(CCN2CCCNCC2)CC1 |
| InChI | InChI=1S/C13H25N3/c1-13-3-8-16(9-4-13)12-11-15-7-2-5-14-6-10-15/h3,14H,2,4-12H2,1H3 |
| InChIKey | WFTUDMISZNMDAB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|