C15H19N3OS — CID 114411011
6-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,3-benzothiazol-2-amine (PubChem CID 114411011) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 6-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 114411011 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 6-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-1,3-benzothiazol-2-amine |
| SMILES | COCC1=CCN(Cc2ccc3nc(N)sc3c2)CC1 |
| InChI | InChI=1S/C15H19N3OS/c1-19-10-11-4-6-18(7-5-11)9-12-2-3-13-14(8-12)20-15(16)17-13/h2-4,8H,5-7,9-10H2,1H3,(H2,16,17) |
| InChIKey | FZPUAQFULWDEDU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|