C14H15ClN2O4 — CID 114411594
5-chloro-4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-2-methoxybenzoic acid (PubChem CID 114411594) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is 5-chloro-4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-2-methoxybenzoic acid.
| Compound Name | 5-chloro-4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 114411594 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-chloro-4-(3,6-dihydro-2H-pyridine-1-carbonylamino)-2-methoxybenzoic acid |
| SMILES | COc1cc(NC(=O)N2CC=CCC2)c(Cl)cc1C(=O)O |
| InChI | InChI=1S/C14H15ClN2O4/c1-21-12-8-11(10(15)7-9(12)13(18)19)16-14(20)17-5-3-2-4-6-17/h2-3,7-8H,4-6H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | BYMNIXYHCNCLEA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|