2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid

C20H14BrNO4 — CID 11441298

IUPAC2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid
SMILESO=C(Nc1ccccc1C(=O)O)c1ccc(Br)c(Oc2ccccc2)c1
InChIInChI=1S/C20H14BrNO4/c21-16-11-10-13(12-18(16)26-14-6-2-1-3-7-14)19(23)22-17-9-5-4-8-15(17)20(24)25/h1-12H,(H,22,23)(H,24,25)
InChIKeyXOENRMSDPFHAEO-UHFFFAOYSA-N
MW412.24 g/mol
LogP5.19
Rot. Bonds5

About 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid

2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid (PubChem CID 11441298) has the molecular formula C20H14BrNO4 and a molecular weight of 412.24 g/mol. Its IUPAC name is 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid
PubChem CID11441298
Molecular FormulaC20H14BrNO4
Molecular Weight412.24 g/mol
Exact Mass411.01
IUPAC Name2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid
SMILESO=C(Nc1ccccc1C(=O)O)c1ccc(Br)c(Oc2ccccc2)c1
InChIInChI=1S/C20H14BrNO4/c21-16-11-10-13(12-18(16)26-14-6-2-1-3-7-14)19(23)22-17-9-5-4-8-15(17)20(24)25/h1-12H,(H,22,23)(H,24,25)
InChIKeyXOENRMSDPFHAEO-UHFFFAOYSA-N
XLogP5.19
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms26
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500412.24
LogP ≤ 55.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid?
The IUPAC name of 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid (CID 11441298) is 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid.
What is the SMILES notation for 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid?
The canonical SMILES for 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid is O=C(Nc1ccccc1C(=O)O)c1ccc(Br)c(Oc2ccccc2)c1.
What is the InChIKey of 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid?
The InChIKey is XOENRMSDPFHAEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14BrNO4/c21-16-11-10-13(12-18(16)26-14-6-2-1-3-7-14)19(23)22-17-9-5-4-8-15(17)20(24)25/h1-12H,(H,22,23)(H,24,25).
What are the key properties of 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid?
2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid has a molecular weight of 412.24 g/mol, XLogP of 5.19, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-3-phenoxybenzoyl)amino]benzoic acid is sourced from PubChem (CID 11441298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).