C15H17NO3S2 — CID 114413780
[3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1-benzothiophen-2-yl]methanol (PubChem CID 114413780) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is [3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1-benzothiophen-2-yl]methanol.
| Compound Name | [3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1-benzothiophen-2-yl]methanol |
|---|---|
| PubChem CID | 114413780 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [3-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]-1-benzothiophen-2-yl]methanol |
| SMILES | CC1=CCN(S(=O)(=O)c2c(CO)sc3ccccc23)CC1 |
| InChI | InChI=1S/C15H17NO3S2/c1-11-6-8-16(9-7-11)21(18,19)15-12-4-2-3-5-13(12)20-14(15)10-17/h2-6,17H,7-10H2,1H3 |
| InChIKey | OXVGDAIXLNMAOQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|