C26H33N3O2 — CID 11441532
3-[8-methoxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]benzamide (PubChem CID 11441532) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 3-[8-methoxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]benzamide.
| Compound Name | 3-[8-methoxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]benzamide |
|---|---|
| PubChem CID | 11441532 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 3-[8-methoxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]benzamide |
| SMILES | COC1(c2cccc(C(N)=O)c2)C2CCC1CN(Cc1ccc(N3CCCC3)cc1)C2 |
| InChI | InChI=1S/C26H33N3O2/c1-31-26(21-6-4-5-20(15-21)25(27)30)22-9-10-23(26)18-28(17-22)16-19-7-11-24(12-8-19)29-13-2-3-14-29/h4-8,11-12,15,22-23H,2-3,9-10,13-14,16-18H2,1H3,(H2,27,30) |
| InChIKey | SBLKFDMVAQVNLA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|