C27H37N3O4S — CID 91508867
N-[3-[8-hydroxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]phenyl]-2-methoxyethanesulfonamide (PubChem CID 91508867) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is N-[3-[8-hydroxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]phenyl]-2-methoxyethanesulfonamide.
| Compound Name | N-[3-[8-hydroxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]phenyl]-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 91508867 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | N-[3-[8-hydroxy-3-[(4-pyrrolidin-1-ylphenyl)methyl]-3-azabicyclo[3.2.1]octan-8-yl]phenyl]-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1cccc(C2(O)C3CCC2CN(Cc2ccc(N4CCCC4)cc2)C3)c1 |
| InChI | InChI=1S/C27H37N3O4S/c1-34-15-16-35(32,33)28-25-6-4-5-22(17-25)27(31)23-9-10-24(27)20-29(19-23)18-21-7-11-26(12-8-21)30-13-2-3-14-30/h4-8,11-12,17,23-24,28,31H,2-3,9-10,13-16,18-20H2,1H3 |
| InChIKey | PEVJTBJVTQVUIC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|