C27H38N2O4S — CID 91201439
2-methoxy-N-[3-[2-[2-(2-phenylethoxy)ethyl]-2-azabicyclo[3.3.1]nonan-5-yl]phenyl]ethanesulfonamide (PubChem CID 91201439) has the molecular formula C27H38N2O4S and a molecular weight of 486.68 g/mol. Its IUPAC name is 2-methoxy-N-[3-[2-[2-(2-phenylethoxy)ethyl]-2-azabicyclo[3.3.1]nonan-5-yl]phenyl]ethanesulfonamide.
| Compound Name | 2-methoxy-N-[3-[2-[2-(2-phenylethoxy)ethyl]-2-azabicyclo[3.3.1]nonan-5-yl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 91201439 |
| Molecular Formula | C27H38N2O4S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-methoxy-N-[3-[2-[2-(2-phenylethoxy)ethyl]-2-azabicyclo[3.3.1]nonan-5-yl]phenyl]ethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1cccc(C23CCCC(C2)N(CCOCCc2ccccc2)CC3)c1 |
| InChI | InChI=1S/C27H38N2O4S/c1-32-19-20-34(30,31)28-25-10-5-9-24(21-25)27-13-6-11-26(22-27)29(15-14-27)16-18-33-17-12-23-7-3-2-4-8-23/h2-5,7-10,21,26,28H,6,11-20,22H2,1H3 |
| InChIKey | IEQAJUDRSHWPNL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|