C23H38N2O3S — CID 90934843
N-[3-(1-hexan-2-yl-2-azabicyclo[3.3.1]nonan-5-yl)phenyl]-2-methoxyethanesulfonamide (PubChem CID 90934843) has the molecular formula C23H38N2O3S and a molecular weight of 422.64 g/mol. Its IUPAC name is N-[3-(1-hexan-2-yl-2-azabicyclo[3.3.1]nonan-5-yl)phenyl]-2-methoxyethanesulfonamide.
| Compound Name | N-[3-(1-hexan-2-yl-2-azabicyclo[3.3.1]nonan-5-yl)phenyl]-2-methoxyethanesulfonamide |
|---|---|
| PubChem CID | 90934843 |
| Molecular Formula | C23H38N2O3S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-[3-(1-hexan-2-yl-2-azabicyclo[3.3.1]nonan-5-yl)phenyl]-2-methoxyethanesulfonamide |
| SMILES | CCCCC(C)C12CCCC(c3cccc(NS(=O)(=O)CCOC)c3)(CCN1)C2 |
| InChI | InChI=1S/C23H38N2O3S/c1-4-5-8-19(2)23-12-7-11-22(18-23,13-14-24-23)20-9-6-10-21(17-20)25-29(26,27)16-15-28-3/h6,9-10,17,19,24-25H,4-5,7-8,11-16,18H2,1-3H3 |
| InChIKey | BYUWVLRLEWTUCE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |