C11H11F2N — CID 114415538
N-[(2,6-difluorophenyl)methyl]but-3-yn-2-amine (PubChem CID 114415538) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]but-3-yn-2-amine.
| Compound Name | N-[(2,6-difluorophenyl)methyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 114415538 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NCc1c(F)cccc1F |
| InChI | InChI=1S/C11H11F2N/c1-3-8(2)14-7-9-10(12)5-4-6-11(9)13/h1,4-6,8,14H,7H2,2H3 |
| InChIKey | XJEVHFDRNCUXLV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|