C10H11FN2 — CID 130694258
N-[(6-fluoro-3-pyridinyl)methyl]but-3-yn-2-amine (PubChem CID 130694258) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is N-[(6-fluoro-3-pyridinyl)methyl]but-3-yn-2-amine.
| Compound Name | N-[(6-fluoro-3-pyridinyl)methyl]but-3-yn-2-amine |
|---|---|
| PubChem CID | 130694258 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-[(6-fluoro-3-pyridinyl)methyl]but-3-yn-2-amine |
| SMILES | C#CC(C)NCc1ccc(F)nc1 |
| InChI | InChI=1S/C10H11FN2/c1-3-8(2)12-6-9-4-5-10(11)13-7-9/h1,4-5,7-8,12H,6H2,2H3 |
| InChIKey | BASCQVFWVMPBDN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|