C14H24N2 — CID 114416286
1-(aminomethyl)-N-but-3-yn-2-yl-3-cyclopropylcyclohexan-1-amine (PubChem CID 114416286) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-(aminomethyl)-N-but-3-yn-2-yl-3-cyclopropylcyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-N-but-3-yn-2-yl-3-cyclopropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 114416286 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-(aminomethyl)-N-but-3-yn-2-yl-3-cyclopropylcyclohexan-1-amine |
| SMILES | C#CC(C)NC1(CN)CCCC(C2CC2)C1 |
| InChI | InChI=1S/C14H24N2/c1-3-11(2)16-14(10-15)8-4-5-13(9-14)12-6-7-12/h1,11-13,16H,4-10,15H2,2H3 |
| InChIKey | OFGCBTLSNIUCGR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|