C14H26N2 — CID 114415937
1-(aminomethyl)-N-but-3-yn-2-yl-4,4-dimethylcycloheptan-1-amine (PubChem CID 114415937) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-(aminomethyl)-N-but-3-yn-2-yl-4,4-dimethylcycloheptan-1-amine.
| Compound Name | 1-(aminomethyl)-N-but-3-yn-2-yl-4,4-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 114415937 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-(aminomethyl)-N-but-3-yn-2-yl-4,4-dimethylcycloheptan-1-amine |
| SMILES | C#CC(C)NC1(CN)CCCC(C)(C)CC1 |
| InChI | InChI=1S/C14H26N2/c1-5-12(2)16-14(11-15)8-6-7-13(3,4)9-10-14/h1,12,16H,6-11,15H2,2-4H3 |
| InChIKey | JSDVAXPVBZZJLG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|