C10H18N2O2S — CID 114416146
4-(aminomethyl)-N-but-3-yn-2-yl-1,1-dioxothian-4-amine (PubChem CID 114416146) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 4-(aminomethyl)-N-but-3-yn-2-yl-1,1-dioxothian-4-amine.
| Compound Name | 4-(aminomethyl)-N-but-3-yn-2-yl-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 114416146 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-(aminomethyl)-N-but-3-yn-2-yl-1,1-dioxothian-4-amine |
| SMILES | C#CC(C)NC1(CN)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H18N2O2S/c1-3-9(2)12-10(8-11)4-6-15(13,14)7-5-10/h1,9,12H,4-8,11H2,2H3 |
| InChIKey | DPUFRXJTDVYUMR-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|